C20H39N5O7 — CID 18308973
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoic acid (PubChem CID 18308973) has the molecular formula C20H39N5O7 and a molecular weight of 461.56 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18308973 |
| Molecular Formula | C20H39N5O7 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]amino]-3-hydroxybutanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(NC(=O)C(NC(=O)C(N)CCCCN)C(C)O)C(C)O)C(=O)O |
| InChI | InChI=1S/C20H39N5O7/c1-5-10(2)14(20(31)32)23-18(29)16(12(4)27)25-19(30)15(11(3)26)24-17(28)13(22)8-6-7-9-21/h10-16,26-27H,5-9,21-22H2,1-4H3,(H,23,29)(H,24,28)(H,25,30)(H,31,32) |
| InChIKey | UFQOLSKUETUNJY-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 217.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|