C24H47N5O5 — CID 18306078
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-4-methylpentanoyl]amino]-3-methylpentanoic acid (PubChem CID 18306078) has the molecular formula C24H47N5O5 and a molecular weight of 485.67 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-4-methylpentanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-4-methylpentanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18306078 |
| Molecular Formula | C24H47N5O5 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.36 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-4-methylpentanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(N)CCCCN)C(C)CC)C(=O)O |
| InChI | InChI=1S/C24H47N5O5/c1-7-15(5)19(28-21(30)17(26)11-9-10-12-25)23(32)27-18(13-14(3)4)22(31)29-20(24(33)34)16(6)8-2/h14-20H,7-13,25-26H2,1-6H3,(H,27,32)(H,28,30)(H,29,31)(H,33,34) |
| InChIKey | GFTRDXNZANISRL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|