C23H45N5O5 — CID 18306087
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoic acid (PubChem CID 18306087) has the molecular formula C23H45N5O5 and a molecular weight of 471.64 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18306087 |
| Molecular Formula | C23H45N5O5 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.34 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CCCCN)C(=O)NC(CC(C)C)C(=O)NC(C(=O)O)C(C)C |
| InChI | InChI=1S/C23H45N5O5/c1-7-15(6)19(28-20(29)16(25)10-8-9-11-24)22(31)26-17(12-13(2)3)21(30)27-18(14(4)5)23(32)33/h13-19H,7-12,24-25H2,1-6H3,(H,26,31)(H,27,30)(H,28,29)(H,32,33) |
| InChIKey | WNGVLWNEQGVSSB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|