C17H34N4O4 — CID 100934427
(2S,3S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoyl]amino]-3-methylpentanoic acid (PubChem CID 100934427) has the molecular formula C17H34N4O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (2S,3S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 100934427 |
| Molecular Formula | C17H34N4O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | (2S,3S)-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoyl]amino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)[C@@H](N)CCCCN)C(C)C)C(=O)O |
| InChI | InChI=1S/C17H34N4O4/c1-5-11(4)14(17(24)25)21-16(23)13(10(2)3)20-15(22)12(19)8-6-7-9-18/h10-14H,5-9,18-19H2,1-4H3,(H,20,22)(H,21,23)(H,24,25)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | RPWQJSBMXJSCPD-XUXIUFHCSA-N |
| XLogP | 0.20 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|