C11H25Cl2N3O3 — CID 140776126
(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoic acid;dihydrochloride (PubChem CID 140776126) has the molecular formula C11H25Cl2N3O3 and a molecular weight of 318.25 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoic acid;dihydrochloride.
| Compound Name | (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 140776126 |
| Molecular Formula | C11H25Cl2N3O3 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylbutanoic acid;dihydrochloride |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C11H23N3O3.2ClH/c1-7(2)9(11(16)17)14-10(15)8(13)5-3-4-6-12;;/h7-9H,3-6,12-13H2,1-2H3,(H,14,15)(H,16,17);2*1H/t8-,9-;;/m0../s1 |
| InChIKey | CLGFULRLWQVLLT-CDEWPDHBSA-N |
| XLogP | 0.51 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|