C19H35N5O8 — CID 18308723
2-[[3-carboxy-2-[[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]amino]propanoyl]amino]-3-methylbutanoic acid (PubChem CID 18308723) has the molecular formula C19H35N5O8 and a molecular weight of 461.52 g/mol. Its IUPAC name is 2-[[3-carboxy-2-[[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]amino]propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[3-carboxy-2-[[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]amino]propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18308723 |
| Molecular Formula | C19H35N5O8 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 2-[[3-carboxy-2-[[2-(2,6-diaminohexanoylamino)-3-hydroxybutanoyl]amino]propanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)C(CC(=O)O)NC(=O)C(NC(=O)C(N)CCCCN)C(C)O)C(=O)O |
| InChI | InChI=1S/C19H35N5O8/c1-9(2)14(19(31)32)23-17(29)12(8-13(26)27)22-18(30)15(10(3)25)24-16(28)11(21)6-4-5-7-20/h9-12,14-15,25H,4-8,20-21H2,1-3H3,(H,22,30)(H,23,29)(H,24,28)(H,26,27)(H,31,32) |
| InChIKey | VQXJOMUIXXSTKW-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 234.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|