C15H29N5O5 — CID 18305235
2-[[2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]acetyl]amino]-3-methylbutanoic acid (PubChem CID 18305235) has the molecular formula C15H29N5O5 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]acetyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18305235 |
| Molecular Formula | C15H29N5O5 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]acetyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)CNC(=O)CNC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C15H29N5O5/c1-9(2)13(15(24)25)20-12(22)8-18-11(21)7-19-14(23)10(17)5-3-4-6-16/h9-10,13H,3-8,16-17H2,1-2H3,(H,18,21)(H,19,23)(H,20,22)(H,24,25) |
| InChIKey | LFCUIDARSGFWET-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|