C15H29N5O6 — CID 18302481
2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]acetyl]amino]-3-hydroxybutanoic acid (PubChem CID 18302481) has the molecular formula C15H29N5O6 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]acetyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]acetyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18302481 |
| Molecular Formula | C15H29N5O6 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]acetyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(NC(=O)C(N)CCCCN)C(=O)NCC(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C15H29N5O6/c1-8(19-14(24)10(17)5-3-4-6-16)13(23)18-7-11(22)20-12(9(2)21)15(25)26/h8-10,12,21H,3-7,16-17H2,1-2H3,(H,18,23)(H,19,24)(H,20,22)(H,25,26) |
| InChIKey | WVESJIKHXLTFQB-UHFFFAOYSA-N |
| XLogP | -2.99 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|