(2S)-2-(2,6-diaminohexanoylamino)propanoic acid

C9H19N3O3 — CID 130447045

IUPAC(2S)-2-(2,6-diaminohexanoylamino)propanoic acid
SMILESC[C@H](NC(=O)C(N)CCCCN)C(=O)O
InChIInChI=1S/C9H19N3O3/c1-6(9(14)15)12-8(13)7(11)4-2-3-5-10/h6-7H,2-5,10-11H2,1H3,(H,12,13)(H,14,15)/t6-,7?/m0/s1
InChIKeyQOOWRKBDDXQRHC-PKPIPKONSA-N
MW217.27 g/mol
LogP-0.97
Rot. Bonds7

About (2S)-2-(2,6-diaminohexanoylamino)propanoic acid

(2S)-2-(2,6-diaminohexanoylamino)propanoic acid (PubChem CID 130447045) has the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. Its IUPAC name is (2S)-2-(2,6-diaminohexanoylamino)propanoic acid.

Molecular Properties

Compound Name(2S)-2-(2,6-diaminohexanoylamino)propanoic acid
PubChem CID130447045
Molecular FormulaC9H19N3O3
Molecular Weight217.27 g/mol
Exact Mass217.14
IUPAC Name(2S)-2-(2,6-diaminohexanoylamino)propanoic acid
SMILESC[C@H](NC(=O)C(N)CCCCN)C(=O)O
InChIInChI=1S/C9H19N3O3/c1-6(9(14)15)12-8(13)7(11)4-2-3-5-10/h6-7H,2-5,10-11H2,1H3,(H,12,13)(H,14,15)/t6-,7?/m0/s1
InChIKeyQOOWRKBDDXQRHC-PKPIPKONSA-N
XLogP-0.97
TPSA118.44 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.27
LogP ≤ 5-0.97
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze (2S)-2-(2,6-diaminohexanoylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(2,6-diaminohexanoylamino)propanoic acid?
The IUPAC name of (2S)-2-(2,6-diaminohexanoylamino)propanoic acid (CID 130447045) is (2S)-2-(2,6-diaminohexanoylamino)propanoic acid.
What is the SMILES notation for (2S)-2-(2,6-diaminohexanoylamino)propanoic acid?
The canonical SMILES for (2S)-2-(2,6-diaminohexanoylamino)propanoic acid is C[C@H](NC(=O)C(N)CCCCN)C(=O)O.
What is the InChIKey of (2S)-2-(2,6-diaminohexanoylamino)propanoic acid?
The InChIKey is QOOWRKBDDXQRHC-PKPIPKONSA-N. The full InChI is InChI=1S/C9H19N3O3/c1-6(9(14)15)12-8(13)7(11)4-2-3-5-10/h6-7H,2-5,10-11H2,1H3,(H,12,13)(H,14,15)/t6-,7?/m0/s1.
What are the key properties of (2S)-2-(2,6-diaminohexanoylamino)propanoic acid?
(2S)-2-(2,6-diaminohexanoylamino)propanoic acid has a molecular weight of 217.27 g/mol, XLogP of -0.97, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2,6-diaminohexanoylamino)propanoic acid is sourced from PubChem (CID 130447045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).