C12H26N4O5 — CID 71340750
2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid (PubChem CID 71340750) has the molecular formula C12H26N4O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid.
| Compound Name | 2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid |
|---|---|
| PubChem CID | 71340750 |
| Molecular Formula | C12H26N4O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid |
| SMILES | CC(N)C(=O)NC(C)C(=O)O.NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C6H12N2O3.C6H14N2O2/c1-3(7)5(9)8-4(2)6(10)11;7-4-2-1-3-5(8)6(9)10/h3-4H,7H2,1-2H3,(H,8,9)(H,10,11);5H,1-4,7-8H2,(H,9,10) |
| InChIKey | NNMKIPKDJJVWKP-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 181.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|