2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid

C12H26N4O5 — CID 71340750

IUPAC2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid
SMILESCC(N)C(=O)NC(C)C(=O)O.NCCCCC(N)C(=O)O
InChIInChI=1S/C6H12N2O3.C6H14N2O2/c1-3(7)5(9)8-4(2)6(10)11;7-4-2-1-3-5(8)6(9)10/h3-4H,7H2,1-2H3,(H,8,9)(H,10,11);5H,1-4,7-8H2,(H,9,10)
InChIKeyNNMKIPKDJJVWKP-UHFFFAOYSA-N
MW306.36 g/mol
LogP-1.55
Rot. Bonds8

About 2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid

2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid (PubChem CID 71340750) has the molecular formula C12H26N4O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid.

Molecular Properties

Compound Name2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid
PubChem CID71340750
Molecular FormulaC12H26N4O5
Molecular Weight306.36 g/mol
Exact Mass306.19
IUPAC Name2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid
SMILESCC(N)C(=O)NC(C)C(=O)O.NCCCCC(N)C(=O)O
InChIInChI=1S/C6H12N2O3.C6H14N2O2/c1-3(7)5(9)8-4(2)6(10)11;7-4-2-1-3-5(8)6(9)10/h3-4H,7H2,1-2H3,(H,8,9)(H,10,11);5H,1-4,7-8H2,(H,9,10)
InChIKeyNNMKIPKDJJVWKP-UHFFFAOYSA-N
XLogP-1.55
TPSA181.76 Ų
H-Bond Donors6
H-Bond Acceptors6
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500306.36
LogP ≤ 5-1.55
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid?
The IUPAC name of 2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid (CID 71340750) is 2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid.
What is the SMILES notation for 2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid?
The canonical SMILES for 2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid is CC(N)C(=O)NC(C)C(=O)O.NCCCCC(N)C(=O)O.
What is the InChIKey of 2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid?
The InChIKey is NNMKIPKDJJVWKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O3.C6H14N2O2/c1-3(7)5(9)8-4(2)6(10)11;7-4-2-1-3-5(8)6(9)10/h3-4H,7H2,1-2H3,(H,8,9)(H,10,11);5H,1-4,7-8H2,(H,9,10).
What are the key properties of 2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid?
2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid has a molecular weight of 306.36 g/mol, XLogP of -1.55, 8 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminopropanoylamino)propanoic acid;2,6-diaminohexanoic acid is sourced from PubChem (CID 71340750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).