C14H28N4O6 — CID 20637825
(2R)-2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]propanoic acid;(2R)-2-aminopropanoic acid (PubChem CID 20637825) has the molecular formula C14H28N4O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]propanoic acid;(2R)-2-aminopropanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]propanoic acid;(2R)-2-aminopropanoic acid |
|---|---|
| PubChem CID | 20637825 |
| Molecular Formula | C14H28N4O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (2R)-2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]propanoic acid;(2R)-2-aminopropanoic acid |
| SMILES | CC(=O)N[C@@H](CCCCN)C(=O)N[C@H](C)C(=O)O.C[C@@H](N)C(=O)O |
| InChI | InChI=1S/C11H21N3O4.C3H7NO2/c1-7(11(17)18)13-10(16)9(14-8(2)15)5-3-4-6-12;1-2(4)3(5)6/h7,9H,3-6,12H2,1-2H3,(H,13,16)(H,14,15)(H,17,18);2H,4H2,1H3,(H,5,6)/t7-,9+;2-/m11/s1 |
| InChIKey | NHZXLNUGODQWTD-RYDIRNQTSA-N |
| XLogP | -1.37 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|