C19H37N7O6 — CID 22656687
2-[[6-amino-2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]hexanoyl]amino]propanoic acid (PubChem CID 22656687) has the molecular formula C19H37N7O6 and a molecular weight of 459.55 g/mol. Its IUPAC name is 2-[[6-amino-2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]hexanoyl]amino]propanoic acid.
| Compound Name | 2-[[6-amino-2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 22656687 |
| Molecular Formula | C19H37N7O6 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | 2-[[6-amino-2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]hexanoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C19H37N7O6/c1-11(19(31)32)24-17(29)13(6-2-4-8-20)26-18(30)14(7-3-5-9-21)25-16(28)12(22)10-15(23)27/h11-14H,2-10,20-22H2,1H3,(H2,23,27)(H,24,29)(H,25,28)(H,26,30)(H,31,32) |
| InChIKey | UUHVDKFIWKLFMO-UHFFFAOYSA-N |
| XLogP | -2.99 |
| TPSA | 245.75 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|