C18H36N6O5 — CID 175703983
(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]propanoyl]amino]hexanoyl]amino]propanoic acid (PubChem CID 175703983) has the molecular formula C18H36N6O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]propanoyl]amino]hexanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]propanoyl]amino]hexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 175703983 |
| Molecular Formula | C18H36N6O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2,6-diaminohexanoyl]amino]propanoyl]amino]hexanoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@@H](N)CCCCN)C(=O)O |
| InChI | InChI=1S/C18H36N6O5/c1-11(22-16(26)13(21)7-3-5-9-19)15(25)24-14(8-4-6-10-20)17(27)23-12(2)18(28)29/h11-14H,3-10,19-21H2,1-2H3,(H,22,26)(H,23,27)(H,24,25)(H,28,29)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | LZHIXYQQNCJQSQ-XUXIUFHCSA-N |
| XLogP | -1.85 |
| TPSA | 202.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|