C14H26N4O6 — CID 10360239
(4S)-5-[[(1R)-1-carboxyethyl]amino]-4-[[(2S)-2,6-diaminohexanoyl]amino]-5-oxopentanoic acid (PubChem CID 10360239) has the molecular formula C14H26N4O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is (4S)-5-[[(1R)-1-carboxyethyl]amino]-4-[[(2S)-2,6-diaminohexanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-[[(1R)-1-carboxyethyl]amino]-4-[[(2S)-2,6-diaminohexanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10360239 |
| Molecular Formula | C14H26N4O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (4S)-5-[[(1R)-1-carboxyethyl]amino]-4-[[(2S)-2,6-diaminohexanoyl]amino]-5-oxopentanoic acid |
| SMILES | C[C@@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)CCCCN)C(=O)O |
| InChI | InChI=1S/C14H26N4O6/c1-8(14(23)24)17-13(22)10(5-6-11(19)20)18-12(21)9(16)4-2-3-7-15/h8-10H,2-7,15-16H2,1H3,(H,17,22)(H,18,21)(H,19,20)(H,23,24)/t8-,9+,10+/m1/s1 |
| InChIKey | GJJQCBVRWDGLMQ-UTLUCORTSA-N |
| XLogP | -1.62 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|