C17H32N4O6 — CID 175926003
(2S)-2-[[(2S)-4-carboxy-2-[[(2R)-2,6-diaminohexanoyl]amino]butanoyl]amino]-4-methylpentanoic acid (PubChem CID 175926003) has the molecular formula C17H32N4O6 and a molecular weight of 388.47 g/mol. Its IUPAC name is (2S)-2-[[(2S)-4-carboxy-2-[[(2R)-2,6-diaminohexanoyl]amino]butanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-4-carboxy-2-[[(2R)-2,6-diaminohexanoyl]amino]butanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 175926003 |
| Molecular Formula | C17H32N4O6 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | (2S)-2-[[(2S)-4-carboxy-2-[[(2R)-2,6-diaminohexanoyl]amino]butanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](N)CCCCN)C(=O)O |
| InChI | InChI=1S/C17H32N4O6/c1-10(2)9-13(17(26)27)21-16(25)12(6-7-14(22)23)20-15(24)11(19)5-3-4-8-18/h10-13H,3-9,18-19H2,1-2H3,(H,20,24)(H,21,25)(H,22,23)(H,26,27)/t11-,12+,13+/m1/s1 |
| InChIKey | DCRWPTBMWMGADO-AGIUHOORSA-N |
| XLogP | -0.59 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|