C22H39N5O9 — CID 22697101
2-[[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid (PubChem CID 22697101) has the molecular formula C22H39N5O9 and a molecular weight of 517.58 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 22697101 |
| Molecular Formula | C22H39N5O9 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CCC(=O)O)NC(=O)C(CCCCN)NC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H39N5O9/c1-12(2)11-16(22(35)36)27-21(34)15(7-9-18(30)31)26-20(33)14(5-3-4-10-23)25-19(32)13(24)6-8-17(28)29/h12-16H,3-11,23-24H2,1-2H3,(H,25,32)(H,26,33)(H,27,34)(H,28,29)(H,30,31)(H,35,36) |
| InChIKey | MMHNMNYXCNIVPR-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 251.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|