C22H40N6O8 — CID 18480980
2-[[6-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylpentanoyl]amino]hexanoyl]amino]pentanedioic acid (PubChem CID 18480980) has the molecular formula C22H40N6O8 and a molecular weight of 516.60 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylpentanoyl]amino]hexanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylpentanoyl]amino]hexanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18480980 |
| Molecular Formula | C22H40N6O8 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylpentanoyl]amino]hexanoyl]amino]pentanedioic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCC(N)=O)C(=O)NC(CCCCN)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H40N6O8/c1-12(2)11-16(28-19(32)13(24)6-8-17(25)29)21(34)26-14(5-3-4-10-23)20(33)27-15(22(35)36)7-9-18(30)31/h12-16H,3-11,23-24H2,1-2H3,(H2,25,29)(H,26,34)(H,27,33)(H,28,32)(H,30,31)(H,35,36) |
| InChIKey | RTZVJDPXEUXYOW-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 257.03 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|