C19H34N6O8 — CID 18478774
6-amino-2-[2-[[4-carboxy-2-[(2,5-diamino-5-oxopentanoyl)amino]butanoyl]amino]propanoylamino]hexanoic acid (PubChem CID 18478774) has the molecular formula C19H34N6O8 and a molecular weight of 474.52 g/mol. Its IUPAC name is 6-amino-2-[2-[[4-carboxy-2-[(2,5-diamino-5-oxopentanoyl)amino]butanoyl]amino]propanoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[2-[[4-carboxy-2-[(2,5-diamino-5-oxopentanoyl)amino]butanoyl]amino]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 18478774 |
| Molecular Formula | C19H34N6O8 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 6-amino-2-[2-[[4-carboxy-2-[(2,5-diamino-5-oxopentanoyl)amino]butanoyl]amino]propanoylamino]hexanoic acid |
| SMILES | CC(NC(=O)C(CCC(=O)O)NC(=O)C(N)CCC(N)=O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C19H34N6O8/c1-10(16(29)25-13(19(32)33)4-2-3-9-20)23-18(31)12(6-8-15(27)28)24-17(30)11(21)5-7-14(22)26/h10-13H,2-9,20-21H2,1H3,(H2,22,26)(H,23,31)(H,24,30)(H,25,29)(H,27,28)(H,32,33) |
| InChIKey | DJXHYUOAEAUMAD-UHFFFAOYSA-N |
| XLogP | -2.87 |
| TPSA | 257.03 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|