C19H35N7O7 — CID 18302451
5-amino-2-[[5-amino-2-[2-(2,6-diaminohexanoylamino)propanoylamino]-5-oxopentanoyl]amino]-5-oxopentanoic acid (PubChem CID 18302451) has the molecular formula C19H35N7O7 and a molecular weight of 473.53 g/mol. Its IUPAC name is 5-amino-2-[[5-amino-2-[2-(2,6-diaminohexanoylamino)propanoylamino]-5-oxopentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[5-amino-2-[2-(2,6-diaminohexanoylamino)propanoylamino]-5-oxopentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18302451 |
| Molecular Formula | C19H35N7O7 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | 5-amino-2-[[5-amino-2-[2-(2,6-diaminohexanoylamino)propanoylamino]-5-oxopentanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(NC(=O)C(N)CCCCN)C(=O)NC(CCC(N)=O)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C19H35N7O7/c1-10(24-17(30)11(21)4-2-3-9-20)16(29)25-12(5-7-14(22)27)18(31)26-13(19(32)33)6-8-15(23)28/h10-13H,2-9,20-21H2,1H3,(H2,22,27)(H2,23,28)(H,24,30)(H,25,29)(H,26,31)(H,32,33) |
| InChIKey | JNVGQIFNKVCPBK-UHFFFAOYSA-N |
| XLogP | -3.47 |
| TPSA | 262.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | -3.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|