C17H32N6O7 — CID 18482765
6-amino-2-[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-hydroxypropanoyl]amino]propanoylamino]hexanoic acid (PubChem CID 18482765) has the molecular formula C17H32N6O7 and a molecular weight of 432.48 g/mol. Its IUPAC name is 6-amino-2-[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-hydroxypropanoyl]amino]propanoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-hydroxypropanoyl]amino]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 18482765 |
| Molecular Formula | C17H32N6O7 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 6-amino-2-[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-hydroxypropanoyl]amino]propanoylamino]hexanoic acid |
| SMILES | CC(NC(=O)C(CO)NC(=O)C(N)CCC(N)=O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C17H32N6O7/c1-9(14(26)22-11(17(29)30)4-2-3-7-18)21-16(28)12(8-24)23-15(27)10(19)5-6-13(20)25/h9-12,24H,2-8,18-19H2,1H3,(H2,20,25)(H,21,28)(H,22,26)(H,23,27)(H,29,30) |
| InChIKey | OSPGXXCOHSSMOF-UHFFFAOYSA-N |
| XLogP | -3.74 |
| TPSA | 239.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | -3.74 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|