C23H44N6O6 — CID 18480966
6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid (PubChem CID 18480966) has the molecular formula C23H44N6O6 and a molecular weight of 500.64 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18480966 |
| Molecular Formula | C23H44N6O6 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]hexanoic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C23H44N6O6/c1-13(2)11-17(28-20(31)15(25)8-9-19(26)30)22(33)29-18(12-14(3)4)21(32)27-16(23(34)35)7-5-6-10-24/h13-18H,5-12,24-25H2,1-4H3,(H2,26,30)(H,27,32)(H,28,31)(H,29,33)(H,34,35) |
| InChIKey | OROAFWFFZLIPCJ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|