C23H44N6O7 — CID 18306770
2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid (PubChem CID 18306770) has the molecular formula C23H44N6O7 and a molecular weight of 516.64 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18306770 |
| Molecular Formula | C23H44N6O7 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CCC(=O)O)NC(=O)C(CCCCN)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C23H44N6O7/c1-14(2)13-18(23(35)36)29-22(34)17(9-10-19(30)31)28-21(33)16(8-4-6-12-25)27-20(32)15(26)7-3-5-11-24/h14-18H,3-13,24-26H2,1-2H3,(H,27,32)(H,28,33)(H,29,34)(H,30,31)(H,35,36) |
| InChIKey | LYYGBRHNRSJVHV-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 239.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|