C19H38N6O6 — CID 18302558
2-[[6-amino-2-[2-(2,6-diaminohexanoylamino)propanoylamino]hexanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18302558) has the molecular formula C19H38N6O6 and a molecular weight of 446.55 g/mol. Its IUPAC name is 2-[[6-amino-2-[2-(2,6-diaminohexanoylamino)propanoylamino]hexanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[6-amino-2-[2-(2,6-diaminohexanoylamino)propanoylamino]hexanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18302558 |
| Molecular Formula | C19H38N6O6 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | 2-[[6-amino-2-[2-(2,6-diaminohexanoylamino)propanoylamino]hexanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(NC(=O)C(N)CCCCN)C(=O)NC(CCCCN)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C19H38N6O6/c1-11(23-17(28)13(22)7-3-5-9-20)16(27)24-14(8-4-6-10-21)18(29)25-15(12(2)26)19(30)31/h11-15,26H,3-10,20-22H2,1-2H3,(H,23,28)(H,24,27)(H,25,29)(H,30,31) |
| InChIKey | ZRCXFNMIQFKNJP-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 222.89 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|