C15H30N4O5S — CID 18222550
2-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18222550) has the molecular formula C15H30N4O5S and a molecular weight of 378.50 g/mol. Its IUPAC name is 2-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18222550 |
| Molecular Formula | C15H30N4O5S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CSCCC(NC(=O)C(N)CCCCN)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C15H30N4O5S/c1-9(20)12(15(23)24)19-14(22)11(6-8-25-2)18-13(21)10(17)5-3-4-7-16/h9-12,20H,3-8,16-17H2,1-2H3,(H,18,21)(H,19,22)(H,23,24) |
| InChIKey | IPSDPDAOSAEWCN-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|