C19H37N5O5S2 — CID 18307149
2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-3-sulfanylpropanoyl]amino]-3-methylbutanoic acid (PubChem CID 18307149) has the molecular formula C19H37N5O5S2 and a molecular weight of 479.67 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-3-sulfanylpropanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-3-sulfanylpropanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18307149 |
| Molecular Formula | C19H37N5O5S2 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylsulfanylbutanoyl]amino]-3-sulfanylpropanoyl]amino]-3-methylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(N)CCCCN)C(=O)NC(CS)C(=O)NC(C(=O)O)C(C)C |
| InChI | InChI=1S/C19H37N5O5S2/c1-11(2)15(19(28)29)24-18(27)14(10-30)23-17(26)13(7-9-31-3)22-16(25)12(21)6-4-5-8-20/h11-15,30H,4-10,20-21H2,1-3H3,(H,22,25)(H,23,26)(H,24,27)(H,28,29) |
| InChIKey | PWDPCPIKPUIDSP-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|