C16H32N4O5 — CID 145456473
Leu-Lys-Thr (PubChem CID 145456473) has the molecular formula C16H32N4O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (2S,3R)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-4-methylpentanoyl]amino]hexanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | Leu-Lys-Thr |
|---|---|
| PubChem CID | 145456473 |
| Molecular Formula | C16H32N4O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | (2S,3R)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-4-methylpentanoyl]amino]hexanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(C)C)N)O |
| InChI | InChI=1S/C16H32N4O5/c1-9(2)8-11(18)14(22)19-12(6-4-5-7-17)15(23)20-13(10(3)21)16(24)25/h9-13,21H,4-8,17-18H2,1-3H3,(H,19,22)(H,20,23)(H,24,25)/t10-,11+,12+,13+/m1/s1 |
| InChIKey | OVZLLFONXILPDZ-VOAKCMCISA-N |
| XLogP | -3.70 |
| TPSA | 168.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | 444 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|