C19H37N5O6 — CID 18237156
2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-4-methylpentanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18237156) has the molecular formula C19H37N5O6 and a molecular weight of 431.53 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-4-methylpentanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-4-methylpentanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18237156 |
| Molecular Formula | C19H37N5O6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | 2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-4-methylpentanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CCCCN)NC(=O)C(C)N)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C19H37N5O6/c1-10(2)9-14(18(28)24-15(12(4)25)19(29)30)23-17(27)13(7-5-6-8-20)22-16(26)11(3)21/h10-15,25H,5-9,20-21H2,1-4H3,(H,22,26)(H,23,27)(H,24,28)(H,29,30) |
| InChIKey | MMZPWFQYKOIGPQ-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|