C22H35N5O6 — CID 18237971
2-[[6-amino-2-[[2-(2-aminopropanoylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 18237971) has the molecular formula C22H35N5O6 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-(2-aminopropanoylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-(2-aminopropanoylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 18237971 |
| Molecular Formula | C22H35N5O6 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | 2-[[6-amino-2-[[2-(2-aminopropanoylamino)-3-phenylpropanoyl]amino]hexanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | CC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(=O)NC(C(=O)O)C(C)O |
| InChI | InChI=1S/C22H35N5O6/c1-13(24)19(29)26-17(12-15-8-4-3-5-9-15)21(31)25-16(10-6-7-11-23)20(30)27-18(14(2)28)22(32)33/h3-5,8-9,13-14,16-18,28H,6-7,10-12,23-24H2,1-2H3,(H,25,31)(H,26,29)(H,27,30)(H,32,33) |
| InChIKey | QIFACYIMDUZGCE-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|