C21H33N5O6 — CID 18238762
2-[[6-amino-2-[[2-(2-aminopropanoylamino)-3-hydroxypropanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18238762) has the molecular formula C21H33N5O6 and a molecular weight of 451.52 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-(2-aminopropanoylamino)-3-hydroxypropanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-(2-aminopropanoylamino)-3-hydroxypropanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18238762 |
| Molecular Formula | C21H33N5O6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 2-[[6-amino-2-[[2-(2-aminopropanoylamino)-3-hydroxypropanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(N)C(=O)NC(CO)C(=O)NC(CCCCN)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H33N5O6/c1-13(23)18(28)26-17(12-27)20(30)24-15(9-5-6-10-22)19(29)25-16(21(31)32)11-14-7-3-2-4-8-14/h2-4,7-8,13,15-17,27H,5-6,9-12,22-23H2,1H3,(H,24,30)(H,25,29)(H,26,28)(H,31,32) |
| InChIKey | GTZLJKLZVSNCSX-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|