C27H37N5O6 — CID 18742534
2-[[6-amino-2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18742534) has the molecular formula C27H37N5O6 and a molecular weight of 527.62 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18742534 |
| Molecular Formula | C27H37N5O6 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.27 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-phenylpropanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CO)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H37N5O6/c28-14-8-7-13-21(25(35)32-23(27(37)38)16-19-11-5-2-6-12-19)30-26(36)22(31-24(34)20(29)17-33)15-18-9-3-1-4-10-18/h1-6,9-12,20-23,33H,7-8,13-17,28-29H2,(H,30,36)(H,31,34)(H,32,35)(H,37,38) |
| InChIKey | VUUSTHIGQKEVLV-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|