C20H31N5O6 — CID 18742528
2-[[6-amino-2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-phenylpropanoyl]amino]hexanoyl]amino]acetic acid (PubChem CID 18742528) has the molecular formula C20H31N5O6 and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-phenylpropanoyl]amino]hexanoyl]amino]acetic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-phenylpropanoyl]amino]hexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18742528 |
| Molecular Formula | C20H31N5O6 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-phenylpropanoyl]amino]hexanoyl]amino]acetic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CO)C(=O)NCC(=O)O |
| InChI | InChI=1S/C20H31N5O6/c21-9-5-4-8-15(19(30)23-11-17(27)28)24-20(31)16(25-18(29)14(22)12-26)10-13-6-2-1-3-7-13/h1-3,6-7,14-16,26H,4-5,8-12,21-22H2,(H,23,30)(H,24,31)(H,25,29)(H,27,28) |
| InChIKey | WWGWILUUWGPION-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|