C23H33N7O5 — CID 18498043
2-[[6-amino-2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]acetic acid (PubChem CID 18498043) has the molecular formula C23H33N7O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]acetic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18498043 |
| Molecular Formula | C23H33N7O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-phenylpropanoyl]amino]hexanoyl]amino]acetic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)Cc1cnc[nH]1)C(=O)NCC(=O)O |
| InChI | InChI=1S/C23H33N7O5/c24-9-5-4-8-18(22(34)27-13-20(31)32)29-23(35)19(10-15-6-2-1-3-7-15)30-21(33)17(25)11-16-12-26-14-28-16/h1-3,6-7,12,14,17-19H,4-5,8-11,13,24-25H2,(H,26,28)(H,27,34)(H,29,35)(H,30,33)(H,31,32) |
| InChIKey | FMVRIFMTYYYUBV-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 205.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|