C24H35N7O5 — CID 18492863
2-[[6-amino-2-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoylamino]hexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18492863) has the molecular formula C24H35N7O5 and a molecular weight of 501.59 g/mol. Its IUPAC name is 2-[[6-amino-2-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoylamino]hexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoylamino]hexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18492863 |
| Molecular Formula | C24H35N7O5 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | 2-[[6-amino-2-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoylamino]hexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CCCCN)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H35N7O5/c1-15(29-22(33)18(26)12-17-13-27-14-28-17)21(32)30-19(9-5-6-10-25)23(34)31-20(24(35)36)11-16-7-3-2-4-8-16/h2-4,7-8,13-15,18-20H,5-6,9-12,25-26H2,1H3,(H,27,28)(H,29,33)(H,30,32)(H,31,34)(H,35,36) |
| InChIKey | CBURCEXHLNYJMW-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 205.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|