C20H33N7O7 — CID 18492855
2-[[6-amino-2-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoylamino]hexanoyl]amino]pentanedioic acid (PubChem CID 18492855) has the molecular formula C20H33N7O7 and a molecular weight of 483.53 g/mol. Its IUPAC name is 2-[[6-amino-2-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoylamino]hexanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[6-amino-2-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoylamino]hexanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18492855 |
| Molecular Formula | C20H33N7O7 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2-[[6-amino-2-[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]propanoylamino]hexanoyl]amino]pentanedioic acid |
| SMILES | CC(NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CCCCN)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H33N7O7/c1-11(25-18(31)13(22)8-12-9-23-10-24-12)17(30)26-14(4-2-3-7-21)19(32)27-15(20(33)34)5-6-16(28)29/h9-11,13-15H,2-8,21-22H2,1H3,(H,23,24)(H,25,31)(H,26,30)(H,27,32)(H,28,29)(H,33,34) |
| InChIKey | SKCSEWPLQWCDPW-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 242.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|