C22H35N7O9 — CID 18305576
2-[[4-carboxy-2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]butanoyl]amino]pentanedioic acid (PubChem CID 18305576) has the molecular formula C22H35N7O9 and a molecular weight of 541.56 g/mol. Its IUPAC name is 2-[[4-carboxy-2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]butanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[4-carboxy-2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]butanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18305576 |
| Molecular Formula | C22H35N7O9 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | 2-[[4-carboxy-2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]butanoyl]amino]pentanedioic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H35N7O9/c23-8-2-1-3-13(24)19(34)29-16(9-12-10-25-11-26-12)21(36)27-14(4-6-17(30)31)20(35)28-15(22(37)38)5-7-18(32)33/h10-11,13-16H,1-9,23-24H2,(H,25,26)(H,27,36)(H,28,35)(H,29,34)(H,30,31)(H,32,33)(H,37,38) |
| InChIKey | IAVXQMPGUSOJFT-UHFFFAOYSA-N |
| XLogP | -2.32 |
| TPSA | 279.92 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|