C20H33N7O7S — CID 18305575
5-[(1-carboxy-2-sulfanylethyl)amino]-4-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid (PubChem CID 18305575) has the molecular formula C20H33N7O7S and a molecular weight of 515.59 g/mol. Its IUPAC name is 5-[(1-carboxy-2-sulfanylethyl)amino]-4-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[(1-carboxy-2-sulfanylethyl)amino]-4-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18305575 |
| Molecular Formula | C20H33N7O7S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 5-[(1-carboxy-2-sulfanylethyl)amino]-4-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CCC(=O)O)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C20H33N7O7S/c21-6-2-1-3-12(22)17(30)26-14(7-11-8-23-10-24-11)19(32)25-13(4-5-16(28)29)18(31)27-15(9-35)20(33)34/h8,10,12-15,35H,1-7,9,21-22H2,(H,23,24)(H,25,32)(H,26,30)(H,27,31)(H,28,29)(H,33,34) |
| InChIKey | GNVJYVJSWLFQSG-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 242.62 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|