C15H26N6O4S — CID 18222406
2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18222406) has the molecular formula C15H26N6O4S and a molecular weight of 386.48 g/mol. Its IUPAC name is 2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18222406 |
| Molecular Formula | C15H26N6O4S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CS)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C15H26N6O4S/c16-4-2-1-3-10(17)13(22)21-12(7-26)14(23)20-11(15(24)25)5-9-6-18-8-19-9/h6,8,10-12,26H,1-5,7,16-17H2,(H,18,19)(H,20,23)(H,21,22)(H,24,25) |
| InChIKey | QQYRCUXKLDGCQN-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 176.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|