C19H31N7O7S — CID 18255911
4-[[6-amino-1-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-1-oxohexan-2-yl]amino]-3-[(2-amino-3-sulfanylpropanoyl)amino]-4-oxobutanoic acid (PubChem CID 18255911) has the molecular formula C19H31N7O7S and a molecular weight of 501.57 g/mol. Its IUPAC name is 4-[[6-amino-1-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-1-oxohexan-2-yl]amino]-3-[(2-amino-3-sulfanylpropanoyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-[[6-amino-1-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-1-oxohexan-2-yl]amino]-3-[(2-amino-3-sulfanylpropanoyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18255911 |
| Molecular Formula | C19H31N7O7S |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | 4-[[6-amino-1-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-1-oxohexan-2-yl]amino]-3-[(2-amino-3-sulfanylpropanoyl)amino]-4-oxobutanoic acid |
| SMILES | NCCCCC(NC(=O)C(CC(=O)O)NC(=O)C(N)CS)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C19H31N7O7S/c20-4-2-1-3-12(17(30)26-14(19(32)33)5-10-7-22-9-23-10)24-18(31)13(6-15(27)28)25-16(29)11(21)8-34/h7,9,11-14,34H,1-6,8,20-21H2,(H,22,23)(H,24,31)(H,25,29)(H,26,30)(H,27,28)(H,32,33) |
| InChIKey | GKLJHHNOZGWLBZ-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 242.62 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|