C20H34N8O6S — CID 18257901
5-amino-2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoyl]amino]-5-oxopentanoic acid (PubChem CID 18257901) has the molecular formula C20H34N8O6S and a molecular weight of 514.61 g/mol. Its IUPAC name is 5-amino-2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18257901 |
| Molecular Formula | C20H34N8O6S |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 5-amino-2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CS)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C20H34N8O6S/c21-6-2-1-3-13(18(31)27-14(20(33)34)4-5-16(23)29)26-19(32)15(7-11-8-24-10-25-11)28-17(30)12(22)9-35/h8,10,12-15,35H,1-7,9,21-22H2,(H2,23,29)(H,24,25)(H,26,32)(H,27,31)(H,28,30)(H,33,34) |
| InChIKey | JTYMMGWEKGXDPG-UHFFFAOYSA-N |
| XLogP | -2.86 |
| TPSA | 248.41 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|