C20H35N7O5S2 — CID 18259046
2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18259046) has the molecular formula C20H35N7O5S2 and a molecular weight of 517.68 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18259046 |
| Molecular Formula | C20H35N7O5S2 |
| Molecular Weight | 517.68 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(CCCCN)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C20H35N7O5S2/c1-34-7-5-15(20(31)32)26-19(30)16(8-12-9-23-11-24-12)27-18(29)14(4-2-3-6-21)25-17(28)13(22)10-33/h9,11,13-16,33H,2-8,10,21-22H2,1H3,(H,23,24)(H,25,28)(H,26,30)(H,27,29)(H,31,32) |
| InChIKey | CRWNSGTYMGRBKK-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 205.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.68 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|