C17H30N6O4S — CID 18222474
2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18222474) has the molecular formula C17H30N6O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18222474 |
| Molecular Formula | C17H30N6O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C17H30N6O4S/c1-28-7-5-13(17(26)27)22-16(25)14(8-11-9-20-10-21-11)23-15(24)12(19)4-2-3-6-18/h9-10,12-14H,2-8,18-19H2,1H3,(H,20,21)(H,22,25)(H,23,24)(H,26,27) |
| InChIKey | YXTKSLRSRXKXNV-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 176.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|