C19H31N7O7 — CID 18305616
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]pentanedioic acid (PubChem CID 18305616) has the molecular formula C19H31N7O7 and a molecular weight of 469.50 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18305616 |
| Molecular Formula | C19H31N7O7 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]acetyl]amino]pentanedioic acid |
| SMILES | NCCCCC(N)C(=O)NC(Cc1cnc[nH]1)C(=O)NCC(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H31N7O7/c20-6-2-1-3-12(21)17(30)26-14(7-11-8-22-10-24-11)18(31)23-9-15(27)25-13(19(32)33)4-5-16(28)29/h8,10,12-14H,1-7,9,20-21H2,(H,22,24)(H,23,31)(H,25,27)(H,26,30)(H,28,29)(H,32,33) |
| InChIKey | ICUXJAFTQBZDMZ-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 242.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|