C19H32N8O6 — CID 18479731
6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid (PubChem CID 18479731) has the molecular formula C19H32N8O6 and a molecular weight of 468.52 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18479731 |
| Molecular Formula | C19H32N8O6 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1cnc[nH]1)NC(=O)CNC(=O)C(N)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C19H32N8O6/c20-6-2-1-3-13(19(32)33)27-18(31)14(7-11-8-23-10-25-11)26-16(29)9-24-17(30)12(21)4-5-15(22)28/h8,10,12-14H,1-7,9,20-21H2,(H2,22,28)(H,23,25)(H,24,30)(H,26,29)(H,27,31)(H,32,33) |
| InChIKey | NNRPYCINSAXKOR-UHFFFAOYSA-N |
| XLogP | -3.16 |
| TPSA | 248.41 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|