C18H29N7O7 — CID 18305239
2-[[2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid (PubChem CID 18305239) has the molecular formula C18H29N7O7 and a molecular weight of 455.47 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18305239 |
| Molecular Formula | C18H29N7O7 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid |
| SMILES | NCCCCC(N)C(=O)NCC(=O)NC(Cc1cnc[nH]1)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H29N7O7/c19-4-2-1-3-11(20)16(29)22-8-14(26)24-12(5-10-7-21-9-23-10)17(30)25-13(18(31)32)6-15(27)28/h7,9,11-13H,1-6,8,19-20H2,(H,21,23)(H,22,29)(H,24,26)(H,25,30)(H,27,28)(H,31,32) |
| InChIKey | VYRIVVBMJVUEAL-UHFFFAOYSA-N |
| XLogP | -2.95 |
| TPSA | 242.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|