C20H34N8O6 — CID 18302491
5-amino-2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid (PubChem CID 18302491) has the molecular formula C20H34N8O6 and a molecular weight of 482.54 g/mol. Its IUPAC name is 5-amino-2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18302491 |
| Molecular Formula | C20H34N8O6 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 5-amino-2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(NC(=O)C(N)CCCCN)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C20H34N8O6/c1-11(26-18(31)13(22)4-2-3-7-21)17(30)28-15(8-12-9-24-10-25-12)19(32)27-14(20(33)34)5-6-16(23)29/h9-11,13-15H,2-8,21-22H2,1H3,(H2,23,29)(H,24,25)(H,26,31)(H,27,32)(H,28,30)(H,33,34) |
| InChIKey | ZQZNDUBFGJQCEP-UHFFFAOYSA-N |
| XLogP | -2.77 |
| TPSA | 248.41 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|