C21H38N8O5 — CID 18306671
2-[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18306671) has the molecular formula C21H38N8O5 and a molecular weight of 482.59 g/mol. Its IUPAC name is 2-[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18306671 |
| Molecular Formula | C21H38N8O5 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | 2-[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CC(NC(=O)C(CCCCN)NC(=O)C(N)CCCCN)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C21H38N8O5/c1-13(18(30)29-17(21(33)34)10-14-11-25-12-26-14)27-20(32)16(7-3-5-9-23)28-19(31)15(24)6-2-4-8-22/h11-13,15-17H,2-10,22-24H2,1H3,(H,25,26)(H,27,32)(H,28,31)(H,29,30)(H,33,34) |
| InChIKey | KQGQSHCJJWWFAV-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 231.34 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|