C21H37N7O5 — CID 18305879
2-[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18305879) has the molecular formula C21H37N7O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18305879 |
| Molecular Formula | C21H37N7O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | 2-[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CCCCN)C(=O)NC(C)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C21H37N7O5/c1-4-12(2)17(28-19(30)15(23)7-5-6-8-22)20(31)26-13(3)18(29)27-16(21(32)33)9-14-10-24-11-25-14/h10-13,15-17H,4-9,22-23H2,1-3H3,(H,24,25)(H,26,31)(H,27,29)(H,28,30)(H,32,33) |
| InChIKey | IYBWJPXHACFRPF-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 205.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|