C20H35N7O5 — CID 18306017
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18306017) has the molecular formula C20H35N7O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18306017 |
| Molecular Formula | C20H35N7O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CCCCN)C(=O)NCC(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C20H35N7O5/c1-3-12(2)17(27-18(29)14(22)6-4-5-7-21)19(30)24-10-16(28)26-15(20(31)32)8-13-9-23-11-25-13/h9,11-12,14-15,17H,3-8,10,21-22H2,1-2H3,(H,23,25)(H,24,30)(H,26,28)(H,27,29)(H,31,32) |
| InChIKey | BPEZQRYJHCKUHC-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 205.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|