C18H31N7O5 — CID 18302334
2-[2-[2-(2,6-diaminohexanoylamino)propanoylamino]propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18302334) has the molecular formula C18H31N7O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is 2-[2-[2-(2,6-diaminohexanoylamino)propanoylamino]propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[2-[2-(2,6-diaminohexanoylamino)propanoylamino]propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18302334 |
| Molecular Formula | C18H31N7O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | 2-[2-[2-(2,6-diaminohexanoylamino)propanoylamino]propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CC(NC(=O)C(N)CCCCN)C(=O)NC(C)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C18H31N7O5/c1-10(24-17(28)13(20)5-3-4-6-19)15(26)23-11(2)16(27)25-14(18(29)30)7-12-8-21-9-22-12/h8-11,13-14H,3-7,19-20H2,1-2H3,(H,21,22)(H,23,26)(H,24,28)(H,25,27)(H,29,30) |
| InChIKey | WQGBPOZXVRPXAN-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 205.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|