C17H26N6O8 — CID 18498611
2-[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]propanoylamino]pentanedioic acid (PubChem CID 18498611) has the molecular formula C17H26N6O8 and a molecular weight of 442.43 g/mol. Its IUPAC name is 2-[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]propanoylamino]pentanedioic acid.
| Compound Name | 2-[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 18498611 |
| Molecular Formula | C17H26N6O8 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-[2-[[2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]propanoylamino]pentanedioic acid |
| SMILES | CC(NC(=O)C(CO)NC(=O)C(N)Cc1cnc[nH]1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H26N6O8/c1-8(14(27)22-11(17(30)31)2-3-13(25)26)21-16(29)12(6-24)23-15(28)10(18)4-9-5-19-7-20-9/h5,7-8,10-12,24H,2-4,6,18H2,1H3,(H,19,20)(H,21,29)(H,22,27)(H,23,28)(H,25,26)(H,30,31) |
| InChIKey | CXKXRMMVVJAAFD-UHFFFAOYSA-N |
| XLogP | -3.30 |
| TPSA | 236.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |